C21H28OSi — CID 173387668
(1-cyclobutyl-2,2-dimethylpropoxy)-diphenylsilane (PubChem CID 173387668) has the molecular formula C21H28OSi and a molecular weight of 324.54 g/mol. Its IUPAC name is (1-cyclobutyl-2,2-dimethylpropoxy)-diphenylsilane.
| Compound Name | (1-cyclobutyl-2,2-dimethylpropoxy)-diphenylsilane |
|---|---|
| PubChem CID | 173387668 |
| Molecular Formula | C21H28OSi |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (1-cyclobutyl-2,2-dimethylpropoxy)-diphenylsilane |
| SMILES | CC(C)(C)C(O[SiH](c1ccccc1)c1ccccc1)C1CCC1 |
| InChI | InChI=1S/C21H28OSi/c1-21(2,3)20(17-11-10-12-17)22-23(18-13-6-4-7-14-18)19-15-8-5-9-16-19/h4-9,13-17,20,23H,10-12H2,1-3H3 |
| InChIKey | QVXCOKXPYKPBFS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|