C45H52O3Si2 — CID 173309254
[(1S,2S,3S)-2,3-bis(1-diphenylsilyloxy-2,2-dimethylpropyl)cyclobutyl]-phenylmethanone (PubChem CID 173309254) has the molecular formula C45H52O3Si2 and a molecular weight of 697.08 g/mol. Its IUPAC name is [(1S,2S,3S)-2,3-bis(1-diphenylsilyloxy-2,2-dimethylpropyl)cyclobutyl]-phenylmethanone.
| Compound Name | [(1S,2S,3S)-2,3-bis(1-diphenylsilyloxy-2,2-dimethylpropyl)cyclobutyl]-phenylmethanone |
|---|---|
| PubChem CID | 173309254 |
| Molecular Formula | C45H52O3Si2 |
| Molecular Weight | 697.08 g/mol |
| Exact Mass | 696.35 |
| IUPAC Name | [(1S,2S,3S)-2,3-bis(1-diphenylsilyloxy-2,2-dimethylpropyl)cyclobutyl]-phenylmethanone |
| SMILES | CC(C)(C)C(O[SiH](c1ccccc1)c1ccccc1)[C@@H]1[C@@H](C(=O)c2ccccc2)C[C@@H]1C(O[SiH](c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C45H52O3Si2/c1-44(2,3)42(47-49(34-24-14-8-15-25-34)35-26-16-9-17-27-35)39-32-38(41(46)33-22-12-7-13-23-33)40(39)43(45(4,5)6)48-50(36-28-18-10-19-29-36)37-30-20-11-21-31-37/h7-31,38-40,42-43,49-50H,32H2,1-6H3/t38-,39-,40+,42?,43?/m0/s1 |
| InChIKey | LKALKUSFNCGDSM-WQJKJSDSSA-N |
| XLogP | 7.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.08 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|