C15H18O2 — CID 102579014
1-[(1R,2S,3R)-3-benzoyl-2-methylcyclopentyl]ethanone (PubChem CID 102579014) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-[(1R,2S,3R)-3-benzoyl-2-methylcyclopentyl]ethanone.
| Compound Name | 1-[(1R,2S,3R)-3-benzoyl-2-methylcyclopentyl]ethanone |
|---|---|
| PubChem CID | 102579014 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-[(1R,2S,3R)-3-benzoyl-2-methylcyclopentyl]ethanone |
| SMILES | CC(=O)[C@@H]1CC[C@@H](C(=O)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C15H18O2/c1-10-13(11(2)16)8-9-14(10)15(17)12-6-4-3-5-7-12/h3-7,10,13-14H,8-9H2,1-2H3/t10-,13+,14+/m0/s1 |
| InChIKey | GRUIYANBSOZUNJ-ZLKJLUDKSA-N |
| XLogP | 3.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |