C23H34N2OSi — CID 173121594
4-(1-diphenylsilyloxy-2,2-dimethylpropyl)cyclohexane-1,2-diamine (PubChem CID 173121594) has the molecular formula C23H34N2OSi and a molecular weight of 382.62 g/mol. Its IUPAC name is 4-(1-diphenylsilyloxy-2,2-dimethylpropyl)cyclohexane-1,2-diamine.
| Compound Name | 4-(1-diphenylsilyloxy-2,2-dimethylpropyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 173121594 |
| Molecular Formula | C23H34N2OSi |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 4-(1-diphenylsilyloxy-2,2-dimethylpropyl)cyclohexane-1,2-diamine |
| SMILES | CC(C)(C)C(O[SiH](c1ccccc1)c1ccccc1)C1CCC(N)C(N)C1 |
| InChI | InChI=1S/C23H34N2OSi/c1-23(2,3)22(17-14-15-20(24)21(25)16-17)26-27(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,17,20-22,27H,14-16,24-25H2,1-3H3 |
| InChIKey | IDVMVRNVMPTPHQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|