C28H45NO6Si — CID 173024422
2-[2-[2-[2-[2-(2-diphenylsilyloxy-3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (PubChem CID 173024422) has the molecular formula C28H45NO6Si and a molecular weight of 519.76 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2-diphenylsilyloxy-3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine.
| Compound Name | 2-[2-[2-[2-[2-(2-diphenylsilyloxy-3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 173024422 |
| Molecular Formula | C28H45NO6Si |
| Molecular Weight | 519.76 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | 2-[2-[2-[2-[2-(2-diphenylsilyloxy-3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| SMILES | CC(C)(C)C(COCCOCCOCCOCCOCCN)O[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H45NO6Si/c1-28(2,3)27(35-36(25-10-6-4-7-11-25)26-12-8-5-9-13-26)24-34-23-22-33-21-20-32-19-18-31-17-16-30-15-14-29/h4-13,27,36H,14-24,29H2,1-3H3 |
| InChIKey | OBQWXRAXMWOLKR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.76 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|