C23H41NO3 — CID 146530606
2-[2-[2-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methoxy]ethoxy]ethoxy]ethanamine (PubChem CID 146530606) has the molecular formula C23H41NO3 and a molecular weight of 379.59 g/mol. Its IUPAC name is 2-[2-[2-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methoxy]ethoxy]ethoxy]ethanamine.
| Compound Name | 2-[2-[2-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 146530606 |
| Molecular Formula | C23H41NO3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | 2-[2-[2-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methoxy]ethoxy]ethoxy]ethanamine |
| SMILES | CC(C)(C)CC(c1ccc(COCCOCCOCCN)cc1)C(C)(C)C |
| InChI | InChI=1S/C23H41NO3/c1-22(2,3)17-21(23(4,5)6)20-9-7-19(8-10-20)18-27-16-15-26-14-13-25-12-11-24/h7-10,21H,11-18,24H2,1-6H3 |
| InChIKey | CACDZWWNMXPYLW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|