C17H27Br — CID 123665434
1-(bromomethyl)-4-(2,2,5,5-tetramethylhexan-3-yl)benzene (PubChem CID 123665434) has the molecular formula C17H27Br and a molecular weight of 311.31 g/mol. Its IUPAC name is 1-(bromomethyl)-4-(2,2,5,5-tetramethylhexan-3-yl)benzene.
| Compound Name | 1-(bromomethyl)-4-(2,2,5,5-tetramethylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 123665434 |
| Molecular Formula | C17H27Br |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-(bromomethyl)-4-(2,2,5,5-tetramethylhexan-3-yl)benzene |
| SMILES | CC(C)(C)CC(c1ccc(CBr)cc1)C(C)(C)C |
| InChI | InChI=1S/C17H27Br/c1-16(2,3)11-15(17(4,5)6)14-9-7-13(12-18)8-10-14/h7-10,15H,11-12H2,1-6H3 |
| InChIKey | LGUAHNOYNHJPMX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|