C46H70BrN — CID 153349721
1-[4-[7-[4-(bromomethyl)phenyl]-2,2,5,6,8,8,9,9,12,12-decamethyl-10-(4-methylphenyl)tridecan-3-yl]phenyl]-N,N-dimethylmethanamine (PubChem CID 153349721) has the molecular formula C46H70BrN and a molecular weight of 716.98 g/mol. Its IUPAC name is 1-[4-[7-[4-(bromomethyl)phenyl]-2,2,5,6,8,8,9,9,12,12-decamethyl-10-(4-methylphenyl)tridecan-3-yl]phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[4-[7-[4-(bromomethyl)phenyl]-2,2,5,6,8,8,9,9,12,12-decamethyl-10-(4-methylphenyl)tridecan-3-yl]phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 153349721 |
| Molecular Formula | C46H70BrN |
| Molecular Weight | 716.98 g/mol |
| Exact Mass | 715.47 |
| IUPAC Name | 1-[4-[7-[4-(bromomethyl)phenyl]-2,2,5,6,8,8,9,9,12,12-decamethyl-10-(4-methylphenyl)tridecan-3-yl]phenyl]-N,N-dimethylmethanamine |
| SMILES | Cc1ccc(C(CC(C)(C)C)C(C)(C)C(C)(C)C(c2ccc(CBr)cc2)C(C)C(C)CC(c2ccc(CN(C)C)cc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C46H70BrN/c1-32-16-22-38(23-17-32)41(29-43(4,5)6)45(10,11)46(12,13)42(39-26-18-35(30-47)19-27-39)34(3)33(2)28-40(44(7,8)9)37-24-20-36(21-25-37)31-48(14)15/h16-27,33-34,40-42H,28-31H2,1-15H3 |
| InChIKey | LJLXILKCOSDKEZ-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.98 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|