C40H65Br — CID 156793058
1-(bromomethyl)-4-[1-(2,3,3,4,4,5-hexamethylhexan-2-yl)-3,3,4,4,7,7-hexamethyl-5-(4-methylphenyl)octyl]benzene (PubChem CID 156793058) has the molecular formula C40H65Br and a molecular weight of 625.86 g/mol. Its IUPAC name is 1-(bromomethyl)-4-[1-(2,3,3,4,4,5-hexamethylhexan-2-yl)-3,3,4,4,7,7-hexamethyl-5-(4-methylphenyl)octyl]benzene.
| Compound Name | 1-(bromomethyl)-4-[1-(2,3,3,4,4,5-hexamethylhexan-2-yl)-3,3,4,4,7,7-hexamethyl-5-(4-methylphenyl)octyl]benzene |
|---|---|
| PubChem CID | 156793058 |
| Molecular Formula | C40H65Br |
| Molecular Weight | 625.86 g/mol |
| Exact Mass | 624.43 |
| IUPAC Name | 1-(bromomethyl)-4-[1-(2,3,3,4,4,5-hexamethylhexan-2-yl)-3,3,4,4,7,7-hexamethyl-5-(4-methylphenyl)octyl]benzene |
| SMILES | Cc1ccc(C(CC(C)(C)C)C(C)(C)C(C)(C)CC(c2ccc(CBr)cc2)C(C)(C)C(C)(C)C(C)(C)C(C)C)cc1 |
| InChI | InChI=1S/C40H65Br/c1-28(2)37(9,10)40(15,16)39(13,14)34(32-23-19-30(27-41)20-24-32)26-36(7,8)38(11,12)33(25-35(4,5)6)31-21-17-29(3)18-22-31/h17-24,28,33-34H,25-27H2,1-16H3 |
| InChIKey | YVFODHXOUPFISN-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.86 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|