C25H45Br — CID 153349722
1-(bromomethyl)-4-(2,2,5,5,6,6,7,7-octamethyloctan-4-yl)benzene;ethane (PubChem CID 153349722) has the molecular formula C25H45Br and a molecular weight of 425.54 g/mol. Its IUPAC name is 1-(bromomethyl)-4-(2,2,5,5,6,6,7,7-octamethyloctan-4-yl)benzene;ethane.
| Compound Name | 1-(bromomethyl)-4-(2,2,5,5,6,6,7,7-octamethyloctan-4-yl)benzene;ethane |
|---|---|
| PubChem CID | 153349722 |
| Molecular Formula | C25H45Br |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 1-(bromomethyl)-4-(2,2,5,5,6,6,7,7-octamethyloctan-4-yl)benzene;ethane |
| SMILES | CC.CC(C)(C)CC(c1ccc(CBr)cc1)C(C)(C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H39Br.C2H6/c1-20(2,3)15-19(18-13-11-17(16-24)12-14-18)22(7,8)23(9,10)21(4,5)6;1-2/h11-14,19H,15-16H2,1-10H3;1-2H3 |
| InChIKey | XPRJOAWNBWYYLM-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|