C10H12BrF3 — CID 160651614
1-(bromomethyl)-4-fluorobenzene;2,2-difluoropropane (PubChem CID 160651614) has the molecular formula C10H12BrF3 and a molecular weight of 269.10 g/mol. Its IUPAC name is 1-(bromomethyl)-4-fluorobenzene;2,2-difluoropropane.
| Compound Name | 1-(bromomethyl)-4-fluorobenzene;2,2-difluoropropane |
|---|---|
| PubChem CID | 160651614 |
| Molecular Formula | C10H12BrF3 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 1-(bromomethyl)-4-fluorobenzene;2,2-difluoropropane |
| SMILES | CC(C)(F)F.Fc1ccc(CBr)cc1 |
| InChI | InChI=1S/C7H6BrF.C3H6F2/c8-5-6-1-3-7(9)4-2-6;1-3(2,4)5/h1-4H,5H2;1-2H3 |
| InChIKey | RKMPOHIGGYTXDC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|