C16H14Br4 — CID 98159586
1-(bromomethyl)-4-[(1R,2S)-1,2-dibromo-2-[4-(bromomethyl)phenyl]ethyl]benzene (PubChem CID 98159586) has the molecular formula C16H14Br4 and a molecular weight of 525.90 g/mol. Its IUPAC name is 1-(bromomethyl)-4-[(1R,2S)-1,2-dibromo-2-[4-(bromomethyl)phenyl]ethyl]benzene.
| Compound Name | 1-(bromomethyl)-4-[(1R,2S)-1,2-dibromo-2-[4-(bromomethyl)phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 98159586 |
| Molecular Formula | C16H14Br4 |
| Molecular Weight | 525.90 g/mol |
| Exact Mass | 521.78 |
| IUPAC Name | 1-(bromomethyl)-4-[(1R,2S)-1,2-dibromo-2-[4-(bromomethyl)phenyl]ethyl]benzene |
| SMILES | BrCc1ccc([C@@H](Br)[C@@H](Br)c2ccc(CBr)cc2)cc1 |
| InChI | InChI=1S/C16H14Br4/c17-9-11-1-5-13(6-2-11)15(19)16(20)14-7-3-12(10-18)4-8-14/h1-8,15-16H,9-10H2/t15-,16+ |
| InChIKey | LYIAPZKOYVAIAG-IYBDPMFKSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.90 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|