C27H47Br — CID 153349728
1-(bromomethyl)-4-(2,2,5,5,6,6,8,8,9,9-decamethyldecan-4-yl)benzene (PubChem CID 153349728) has the molecular formula C27H47Br and a molecular weight of 451.58 g/mol. Its IUPAC name is 1-(bromomethyl)-4-(2,2,5,5,6,6,8,8,9,9-decamethyldecan-4-yl)benzene.
| Compound Name | 1-(bromomethyl)-4-(2,2,5,5,6,6,8,8,9,9-decamethyldecan-4-yl)benzene |
|---|---|
| PubChem CID | 153349728 |
| Molecular Formula | C27H47Br |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 1-(bromomethyl)-4-(2,2,5,5,6,6,8,8,9,9-decamethyldecan-4-yl)benzene |
| SMILES | CC(C)(C)CC(c1ccc(CBr)cc1)C(C)(C)C(C)(C)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H47Br/c1-23(2,3)17-22(21-15-13-20(18-28)14-16-21)27(11,12)26(9,10)19-25(7,8)24(4,5)6/h13-16,22H,17-19H2,1-12H3 |
| InChIKey | UFCJDZNJHIXRFG-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|