C31H54O3 — CID 145337320
ethane;oxiran-2-ylmethyl 2-tert-butyl-2,4,4,5,5,8,8-heptamethyl-6-phenylnonanoate (PubChem CID 145337320) has the molecular formula C31H54O3 and a molecular weight of 474.77 g/mol. Its IUPAC name is ethane;oxiran-2-ylmethyl 2-tert-butyl-2,4,4,5,5,8,8-heptamethyl-6-phenylnonanoate.
| Compound Name | ethane;oxiran-2-ylmethyl 2-tert-butyl-2,4,4,5,5,8,8-heptamethyl-6-phenylnonanoate |
|---|---|
| PubChem CID | 145337320 |
| Molecular Formula | C31H54O3 |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 474.41 |
| IUPAC Name | ethane;oxiran-2-ylmethyl 2-tert-butyl-2,4,4,5,5,8,8-heptamethyl-6-phenylnonanoate |
| SMILES | CC.CC(C)(C)CC(c1ccccc1)C(C)(C)C(C)(C)CC(C)(C(=O)OCC1CO1)C(C)(C)C |
| InChI | InChI=1S/C29H48O3.C2H6/c1-25(2,3)17-23(21-15-13-12-14-16-21)28(9,10)27(7,8)20-29(11,26(4,5)6)24(30)32-19-22-18-31-22;1-2/h12-16,22-23H,17-20H2,1-11H3;1-2H3 |
| InChIKey | SJKCEZLYJAQCRE-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|