C20H27NO3 — CID 23386527
oxiran-2-ylmethyl 6-cyano-2-ethyl-2-methyl-4-phenylheptanoate (PubChem CID 23386527) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is oxiran-2-ylmethyl 6-cyano-2-ethyl-2-methyl-4-phenylheptanoate.
| Compound Name | oxiran-2-ylmethyl 6-cyano-2-ethyl-2-methyl-4-phenylheptanoate |
|---|---|
| PubChem CID | 23386527 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | oxiran-2-ylmethyl 6-cyano-2-ethyl-2-methyl-4-phenylheptanoate |
| SMILES | CCC(C)(CC(CC(C)C#N)c1ccccc1)C(=O)OCC1CO1 |
| InChI | InChI=1S/C20H27NO3/c1-4-20(3,19(22)24-14-18-13-23-18)11-17(10-15(2)12-21)16-8-6-5-7-9-16/h5-9,15,17-18H,4,10-11,13-14H2,1-3H3 |
| InChIKey | KAELUAJAXSLLLZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|