C24H34O6 — CID 23391469
1-O-methyl 5-O-(oxiran-2-ylmethyl) 2-(2-benzoyl-2-methylbutyl)-2,4,4-trimethylpentanedioate (PubChem CID 23391469) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is 1-O-methyl 5-O-(oxiran-2-ylmethyl) 2-(2-benzoyl-2-methylbutyl)-2,4,4-trimethylpentanedioate.
| Compound Name | 1-O-methyl 5-O-(oxiran-2-ylmethyl) 2-(2-benzoyl-2-methylbutyl)-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 23391469 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1-O-methyl 5-O-(oxiran-2-ylmethyl) 2-(2-benzoyl-2-methylbutyl)-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OCC1CO1)C(=O)OC)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H34O6/c1-7-23(4,19(25)17-11-9-8-10-12-17)16-24(5,21(27)28-6)15-22(2,3)20(26)30-14-18-13-29-18/h8-12,18H,7,13-16H2,1-6H3 |
| InChIKey | CQWRZJWBQLRFAS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|