C30H41I3O9 — CID 171726392
3-O-tert-butyl 1-O-(oxiran-2-ylmethyl) 5-O-[2-(2,3,5-triiodobenzoyl)oxyethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 171726392) has the molecular formula C30H41I3O9 and a molecular weight of 926.36 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-(oxiran-2-ylmethyl) 5-O-[2-(2,3,5-triiodobenzoyl)oxyethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-tert-butyl 1-O-(oxiran-2-ylmethyl) 5-O-[2-(2,3,5-triiodobenzoyl)oxyethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 171726392 |
| Molecular Formula | C30H41I3O9 |
| Molecular Weight | 926.36 g/mol |
| Exact Mass | 925.99 |
| IUPAC Name | 3-O-tert-butyl 1-O-(oxiran-2-ylmethyl) 5-O-[2-(2,3,5-triiodobenzoyl)oxyethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OCC1CO1)C(=O)OC(C)(C)C)C(=O)OCCOC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C30H41I3O9/c1-9-29(7,25(36)39-11-10-38-23(34)20-12-18(31)13-21(32)22(20)33)17-30(8,26(37)42-27(2,3)4)16-28(5,6)24(35)41-15-19-14-40-19/h12-13,19H,9-11,14-17H2,1-8H3 |
| InChIKey | BYVVMDLIFDCZDC-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 117.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.36 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|