C34H52O13S — CID 59113789
5-O-(3-hydroxypropyl) 3-O-methyl 7-O-[2-(4-methylphenyl)sulfonyloxyethyl] 1-O-(oxiran-2-ylmethyl) 1,1,3,5,7-pentamethylnonane-1,3,5,7-tetracarboxylate (PubChem CID 59113789) has the molecular formula C34H52O13S and a molecular weight of 700.84 g/mol. Its IUPAC name is 5-O-(3-hydroxypropyl) 3-O-methyl 7-O-[2-(4-methylphenyl)sulfonyloxyethyl] 1-O-(oxiran-2-ylmethyl) 1,1,3,5,7-pentamethylnonane-1,3,5,7-tetracarboxylate.
| Compound Name | 5-O-(3-hydroxypropyl) 3-O-methyl 7-O-[2-(4-methylphenyl)sulfonyloxyethyl] 1-O-(oxiran-2-ylmethyl) 1,1,3,5,7-pentamethylnonane-1,3,5,7-tetracarboxylate |
|---|---|
| PubChem CID | 59113789 |
| Molecular Formula | C34H52O13S |
| Molecular Weight | 700.84 g/mol |
| Exact Mass | 700.31 |
| IUPAC Name | 5-O-(3-hydroxypropyl) 3-O-methyl 7-O-[2-(4-methylphenyl)sulfonyloxyethyl] 1-O-(oxiran-2-ylmethyl) 1,1,3,5,7-pentamethylnonane-1,3,5,7-tetracarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(CC(C)(C)C(=O)OCC1CO1)C(=O)OC)C(=O)OCCCO)C(=O)OCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C34H52O13S/c1-9-32(5,29(38)44-17-18-47-48(40,41)26-13-11-24(2)12-14-26)22-34(7,30(39)43-16-10-15-35)23-33(6,28(37)42-8)21-31(3,4)27(36)46-20-25-19-45-25/h11-14,25,35H,9-10,15-23H2,1-8H3 |
| InChIKey | UNHQPVDPQIKNIC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 181.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|