C35H52O15 — CID 21337917
5-O-(2-hydroxyethyl) 7-O-[2-hydroxy-3-[2-(4-hydroxyphenoxy)acetyl]oxypropyl] 3-O-methyl 1-O-(oxiran-2-ylmethyl) 1,1,3,5,7-pentamethylnonane-1,3,5,7-tetracarboxylate (PubChem CID 21337917) has the molecular formula C35H52O15 and a molecular weight of 712.79 g/mol. Its IUPAC name is 5-O-(2-hydroxyethyl) 7-O-[2-hydroxy-3-[2-(4-hydroxyphenoxy)acetyl]oxypropyl] 3-O-methyl 1-O-(oxiran-2-ylmethyl) 1,1,3,5,7-pentamethylnonane-1,3,5,7-tetracarboxylate.
| Compound Name | 5-O-(2-hydroxyethyl) 7-O-[2-hydroxy-3-[2-(4-hydroxyphenoxy)acetyl]oxypropyl] 3-O-methyl 1-O-(oxiran-2-ylmethyl) 1,1,3,5,7-pentamethylnonane-1,3,5,7-tetracarboxylate |
|---|---|
| PubChem CID | 21337917 |
| Molecular Formula | C35H52O15 |
| Molecular Weight | 712.79 g/mol |
| Exact Mass | 712.33 |
| IUPAC Name | 5-O-(2-hydroxyethyl) 7-O-[2-hydroxy-3-[2-(4-hydroxyphenoxy)acetyl]oxypropyl] 3-O-methyl 1-O-(oxiran-2-ylmethyl) 1,1,3,5,7-pentamethylnonane-1,3,5,7-tetracarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(CC(C)(C)C(=O)OCC1CO1)C(=O)OC)C(=O)OCCO)C(=O)OCC(O)COC(=O)COc1ccc(O)cc1 |
| InChI | InChI=1S/C35H52O15/c1-8-33(4,30(42)49-16-24(38)15-48-27(39)19-47-25-11-9-23(37)10-12-25)21-35(6,31(43)45-14-13-36)22-34(5,29(41)44-7)20-32(2,3)28(40)50-18-26-17-46-26/h9-12,24,26,36-38H,8,13-22H2,1-7H3 |
| InChIKey | ZMJXNTGGQUVHKX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 213.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.79 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|