C32H40O7 — CID 164793550
5-O-(anthracen-9-ylmethyl) 1-O-(2-hydroxyethyl) 3-O-methyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 164793550) has the molecular formula C32H40O7 and a molecular weight of 536.67 g/mol. Its IUPAC name is 5-O-(anthracen-9-ylmethyl) 1-O-(2-hydroxyethyl) 3-O-methyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 5-O-(anthracen-9-ylmethyl) 1-O-(2-hydroxyethyl) 3-O-methyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 164793550 |
| Molecular Formula | C32H40O7 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 5-O-(anthracen-9-ylmethyl) 1-O-(2-hydroxyethyl) 3-O-methyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OCCO)C(=O)OC)C(=O)OCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C32H40O7/c1-7-31(4,21-32(5,28(35)37-6)20-30(2,3)27(34)38-17-16-33)29(36)39-19-26-24-14-10-8-12-22(24)18-23-13-9-11-15-25(23)26/h8-15,18,33H,7,16-17,19-21H2,1-6H3 |
| InChIKey | BJVMLPLWCXBRDI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|