C48H51NO8 — CID 59063122
5-O-(anthracen-9-ylmethyl) 1-O-[3-(anthracen-9-ylmethylideneamino)oxypropyl] 3-O-(2-hydroxyethyl) 1,1,3-trimethylheptane-1,3,5-tricarboxylate (PubChem CID 59063122) has the molecular formula C48H51NO8 and a molecular weight of 769.94 g/mol. Its IUPAC name is 5-O-(anthracen-9-ylmethyl) 1-O-[3-(anthracen-9-ylmethylideneamino)oxypropyl] 3-O-(2-hydroxyethyl) 1,1,3-trimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 5-O-(anthracen-9-ylmethyl) 1-O-[3-(anthracen-9-ylmethylideneamino)oxypropyl] 3-O-(2-hydroxyethyl) 1,1,3-trimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59063122 |
| Molecular Formula | C48H51NO8 |
| Molecular Weight | 769.94 g/mol |
| Exact Mass | 769.36 |
| IUPAC Name | 5-O-(anthracen-9-ylmethyl) 1-O-[3-(anthracen-9-ylmethylideneamino)oxypropyl] 3-O-(2-hydroxyethyl) 1,1,3-trimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(CC(C)(CC(C)(C)C(=O)OCCCON=Cc1c2ccccc2cc2ccccc12)C(=O)OCCO)C(=O)OCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C48H51NO8/c1-5-33(44(51)56-31-43-40-21-12-8-17-36(40)28-37-18-9-13-22-41(37)43)29-48(4,46(53)55-26-23-50)32-47(2,3)45(52)54-24-14-25-57-49-30-42-38-19-10-6-15-34(38)27-35-16-7-11-20-39(35)42/h6-13,15-22,27-28,30,33,50H,5,14,23-26,29,31-32H2,1-4H3 |
| InChIKey | MNLQPDQKWQRVQF-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.94 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|