C46H65NO9 — CID 172916457
9-O-[[(E)-anthracen-9-ylmethylideneamino]oxymethyl] 5-O-(2-hydroxyethyl) 1-O-(oxiran-2-ylmethyl) 1,1,2,2,3,3,5,6,6,7,7-undecamethylundecane-1,5,9-tricarboxylate (PubChem CID 172916457) has the molecular formula C46H65NO9 and a molecular weight of 776.02 g/mol. Its IUPAC name is 9-O-[[(E)-anthracen-9-ylmethylideneamino]oxymethyl] 5-O-(2-hydroxyethyl) 1-O-(oxiran-2-ylmethyl) 1,1,2,2,3,3,5,6,6,7,7-undecamethylundecane-1,5,9-tricarboxylate.
| Compound Name | 9-O-[[(E)-anthracen-9-ylmethylideneamino]oxymethyl] 5-O-(2-hydroxyethyl) 1-O-(oxiran-2-ylmethyl) 1,1,2,2,3,3,5,6,6,7,7-undecamethylundecane-1,5,9-tricarboxylate |
|---|---|
| PubChem CID | 172916457 |
| Molecular Formula | C46H65NO9 |
| Molecular Weight | 776.02 g/mol |
| Exact Mass | 775.47 |
| IUPAC Name | 9-O-[[(E)-anthracen-9-ylmethylideneamino]oxymethyl] 5-O-(2-hydroxyethyl) 1-O-(oxiran-2-ylmethyl) 1,1,2,2,3,3,5,6,6,7,7-undecamethylundecane-1,5,9-tricarboxylate |
| SMILES | CCC(CC(C)(C)C(C)(C)C(C)(CC(C)(C)C(C)(C)C(C)(C)C(=O)OCC1CO1)C(=O)OCCO)C(=O)OCO/N=C/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C46H65NO9/c1-13-31(38(49)55-30-56-47-26-37-35-20-16-14-18-32(35)24-33-19-15-17-21-36(33)37)25-41(2,3)45(10,11)46(12,40(51)52-23-22-48)29-42(4,5)44(8,9)43(6,7)39(50)54-28-34-27-53-34/h14-21,24,26,31,34,48H,13,22-23,25,27-30H2,1-12H3/b47-26+ |
| InChIKey | JAMXMCLUAQWFJG-VKDBKQHDSA-N |
| XLogP | 9.27 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.02 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|