About 9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate
9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate (PubChem CID 123712961) has the molecular formula C26H32O3
and a molecular weight of 392.54 g/mol. Its IUPAC name is 9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate.
Molecular Properties
| Compound Name | 9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate |
| PubChem CID | 123712961 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC1CO1.CCC(C)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C18H18.C8H14O3/c1-3-13(2)18-16-10-6-4-8-14(16)12-15-9-5-7-11-17(15)18;1-3-6(2)8(9)11-5-7-4-10-7/h4-13H,3H2,1-2H3;6-7H,3-5H2,1-2H3 |
| InChIKey | ILHKPTCPMNVLIO-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate?
The IUPAC name of 9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate (CID 123712961) is 9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate.
What is the SMILES notation for 9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate?
The canonical SMILES for 9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate is CCC(C)C(=O)OCC1CO1.CCC(C)c1c2ccccc2cc2ccccc12.
What is the InChIKey of 9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate?
The InChIKey is ILHKPTCPMNVLIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18.C8H14O3/c1-3-13(2)18-16-10-6-4-8-14(16)12-15-9-5-7-11-17(15)18;1-3-6(2)8(9)11-5-7-4-10-7/h4-13H,3H2,1-2H3;6-7H,3-5H2,1-2H3.
What are the key properties of 9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate?
9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate has a molecular weight of 392.54 g/mol, XLogP of 6.48, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butan-2-ylanthracene;oxiran-2-ylmethyl 2-methylbutanoate is sourced from PubChem (CID 123712961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).