C28H34O4 — CID 174717627
2-[1-[2,3-dimethyl-10-[1-(oxiran-2-ylmethoxy)propyl]anthracen-9-yl]propoxymethyl]oxirane (PubChem CID 174717627) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-[1-[2,3-dimethyl-10-[1-(oxiran-2-ylmethoxy)propyl]anthracen-9-yl]propoxymethyl]oxirane.
| Compound Name | 2-[1-[2,3-dimethyl-10-[1-(oxiran-2-ylmethoxy)propyl]anthracen-9-yl]propoxymethyl]oxirane |
|---|---|
| PubChem CID | 174717627 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 2-[1-[2,3-dimethyl-10-[1-(oxiran-2-ylmethoxy)propyl]anthracen-9-yl]propoxymethyl]oxirane |
| SMILES | CCC(OCC1CO1)c1c2ccccc2c(C(CC)OCC2CO2)c2cc(C)c(C)cc12 |
| InChI | InChI=1S/C28H34O4/c1-5-25(31-15-19-13-29-19)27-21-9-7-8-10-22(21)28(26(6-2)32-16-20-14-30-20)24-12-18(4)17(3)11-23(24)27/h7-12,19-20,25-26H,5-6,13-16H2,1-4H3 |
| InChIKey | HHZGAEDOXIBAEE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|