C20H24O2 — CID 14810466
2-[bis(2,6-dimethylphenyl)methoxymethyl]oxirane (PubChem CID 14810466) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-[bis(2,6-dimethylphenyl)methoxymethyl]oxirane.
| Compound Name | 2-[bis(2,6-dimethylphenyl)methoxymethyl]oxirane |
|---|---|
| PubChem CID | 14810466 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-[bis(2,6-dimethylphenyl)methoxymethyl]oxirane |
| SMILES | Cc1cccc(C)c1C(OCC1CO1)c1c(C)cccc1C |
| InChI | InChI=1S/C20H24O2/c1-13-7-5-8-14(2)18(13)20(22-12-17-11-21-17)19-15(3)9-6-10-16(19)4/h5-10,17,20H,11-12H2,1-4H3 |
| InChIKey | LIJMMZBEUVMNQZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|