C12H13F3O2 — CID 97179986
(2S)-2-[[(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethoxy]methyl]oxirane (PubChem CID 97179986) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is (2S)-2-[[(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethoxy]methyl]oxirane.
| Compound Name | (2S)-2-[[(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethoxy]methyl]oxirane |
|---|---|
| PubChem CID | 97179986 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (2S)-2-[[(1R)-2,2,2-trifluoro-1-(2-methylphenyl)ethoxy]methyl]oxirane |
| SMILES | Cc1ccccc1[C@@H](OC[C@@H]1CO1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O2/c1-8-4-2-3-5-10(8)11(12(13,14)15)17-7-9-6-16-9/h2-5,9,11H,6-7H2,1H3/t9-,11+/m0/s1 |
| InChIKey | PTNKLMRIYSJFGP-GXSJLCMTSA-N |
| XLogP | 3.01 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|