C11H9Cl2F3O2 — CID 97179899
(2R)-2-[[(1S)-1-(2,5-dichlorophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane (PubChem CID 97179899) has the molecular formula C11H9Cl2F3O2 and a molecular weight of 301.09 g/mol. Its IUPAC name is (2R)-2-[[(1S)-1-(2,5-dichlorophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane.
| Compound Name | (2R)-2-[[(1S)-1-(2,5-dichlorophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane |
|---|---|
| PubChem CID | 97179899 |
| Molecular Formula | C11H9Cl2F3O2 |
| Molecular Weight | 301.09 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | (2R)-2-[[(1S)-1-(2,5-dichlorophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane |
| SMILES | FC(F)(F)[C@@H](OC[C@H]1CO1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H9Cl2F3O2/c12-6-1-2-9(13)8(3-6)10(11(14,15)16)18-5-7-4-17-7/h1-3,7,10H,4-5H2/t7-,10+/m1/s1 |
| InChIKey | PWBYXZZAWFUOFM-XCBNKYQSSA-N |
| XLogP | 4.01 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.09 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|