C11H10ClF3O2 — CID 102548141
2-[[1-(4-chlorophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane (PubChem CID 102548141) has the molecular formula C11H10ClF3O2 and a molecular weight of 266.65 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane.
| Compound Name | 2-[[1-(4-chlorophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane |
|---|---|
| PubChem CID | 102548141 |
| Molecular Formula | C11H10ClF3O2 |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane |
| SMILES | FC(F)(F)C(OCC1CO1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H10ClF3O2/c12-8-3-1-7(2-4-8)10(11(13,14)15)17-6-9-5-16-9/h1-4,9-10H,5-6H2 |
| InChIKey | IVWDTHJKJYYBRA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|