C12H12ClF3O3 — CID 97179821
(2S)-2-[[(1S)-1-(3-chloro-4-methoxyphenyl)-2,2,2-trifluoroethoxy]methyl]oxirane (PubChem CID 97179821) has the molecular formula C12H12ClF3O3 and a molecular weight of 296.67 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-(3-chloro-4-methoxyphenyl)-2,2,2-trifluoroethoxy]methyl]oxirane.
| Compound Name | (2S)-2-[[(1S)-1-(3-chloro-4-methoxyphenyl)-2,2,2-trifluoroethoxy]methyl]oxirane |
|---|---|
| PubChem CID | 97179821 |
| Molecular Formula | C12H12ClF3O3 |
| Molecular Weight | 296.67 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | (2S)-2-[[(1S)-1-(3-chloro-4-methoxyphenyl)-2,2,2-trifluoroethoxy]methyl]oxirane |
| SMILES | COc1ccc([C@H](OC[C@@H]2CO2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H12ClF3O3/c1-17-10-3-2-7(4-9(10)13)11(12(14,15)16)19-6-8-5-18-8/h2-4,8,11H,5-6H2,1H3/t8-,11-/m0/s1 |
| InChIKey | DIHLPUNDQFPWEC-KWQFWETISA-N |
| XLogP | 3.37 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|