C14H17F3O5 — CID 97179868
(2R)-2-[[(1R)-2,2,2-trifluoro-1-(2,3,4-trimethoxyphenyl)ethoxy]methyl]oxirane (PubChem CID 97179868) has the molecular formula C14H17F3O5 and a molecular weight of 322.28 g/mol. Its IUPAC name is (2R)-2-[[(1R)-2,2,2-trifluoro-1-(2,3,4-trimethoxyphenyl)ethoxy]methyl]oxirane.
| Compound Name | (2R)-2-[[(1R)-2,2,2-trifluoro-1-(2,3,4-trimethoxyphenyl)ethoxy]methyl]oxirane |
|---|---|
| PubChem CID | 97179868 |
| Molecular Formula | C14H17F3O5 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (2R)-2-[[(1R)-2,2,2-trifluoro-1-(2,3,4-trimethoxyphenyl)ethoxy]methyl]oxirane |
| SMILES | COc1ccc([C@@H](OC[C@H]2CO2)C(F)(F)F)c(OC)c1OC |
| InChI | InChI=1S/C14H17F3O5/c1-18-10-5-4-9(11(19-2)12(10)20-3)13(14(15,16)17)22-7-8-6-21-8/h4-5,8,13H,6-7H2,1-3H3/t8-,13-/m1/s1 |
| InChIKey | CCUNHRNQFJPZPO-AMIZOPFISA-N |
| XLogP | 2.73 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|