C12H13F3O3 — CID 97179827
(2R)-2-[[(1S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethoxy]methyl]oxirane (PubChem CID 97179827) has the molecular formula C12H13F3O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is (2R)-2-[[(1S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethoxy]methyl]oxirane.
| Compound Name | (2R)-2-[[(1S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethoxy]methyl]oxirane |
|---|---|
| PubChem CID | 97179827 |
| Molecular Formula | C12H13F3O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (2R)-2-[[(1S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethoxy]methyl]oxirane |
| SMILES | COc1ccc([C@H](OC[C@H]2CO2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3O3/c1-16-9-4-2-8(3-5-9)11(12(13,14)15)18-7-10-6-17-10/h2-5,10-11H,6-7H2,1H3/t10-,11+/m1/s1 |
| InChIKey | XZHWBWSJQDEWON-MNOVXSKESA-N |
| XLogP | 2.71 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|