C13H14BrF3O4 — CID 102548181
2-[[1-(4-bromo-3,5-dimethoxyphenyl)-2,2,2-trifluoroethoxy]methyl]oxirane (PubChem CID 102548181) has the molecular formula C13H14BrF3O4 and a molecular weight of 371.15 g/mol. Its IUPAC name is 2-[[1-(4-bromo-3,5-dimethoxyphenyl)-2,2,2-trifluoroethoxy]methyl]oxirane.
| Compound Name | 2-[[1-(4-bromo-3,5-dimethoxyphenyl)-2,2,2-trifluoroethoxy]methyl]oxirane |
|---|---|
| PubChem CID | 102548181 |
| Molecular Formula | C13H14BrF3O4 |
| Molecular Weight | 371.15 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 2-[[1-(4-bromo-3,5-dimethoxyphenyl)-2,2,2-trifluoroethoxy]methyl]oxirane |
| SMILES | COc1cc(C(OCC2CO2)C(F)(F)F)cc(OC)c1Br |
| InChI | InChI=1S/C13H14BrF3O4/c1-18-9-3-7(4-10(19-2)11(9)14)12(13(15,16)17)21-6-8-5-20-8/h3-4,8,12H,5-6H2,1-2H3 |
| InChIKey | TVJVIUPUYZBLJH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.15 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|