C11H10F4O2 — CID 97179832
(2R)-2-[[(1R)-2,2,2-trifluoro-1-(3-fluorophenyl)ethoxy]methyl]oxirane (PubChem CID 97179832) has the molecular formula C11H10F4O2 and a molecular weight of 250.19 g/mol. Its IUPAC name is (2R)-2-[[(1R)-2,2,2-trifluoro-1-(3-fluorophenyl)ethoxy]methyl]oxirane.
| Compound Name | (2R)-2-[[(1R)-2,2,2-trifluoro-1-(3-fluorophenyl)ethoxy]methyl]oxirane |
|---|---|
| PubChem CID | 97179832 |
| Molecular Formula | C11H10F4O2 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | (2R)-2-[[(1R)-2,2,2-trifluoro-1-(3-fluorophenyl)ethoxy]methyl]oxirane |
| SMILES | Fc1cccc([C@@H](OC[C@H]2CO2)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F4O2/c12-8-3-1-2-7(4-8)10(11(13,14)15)17-6-9-5-16-9/h1-4,9-10H,5-6H2/t9-,10-/m1/s1 |
| InChIKey | SGBBFBKDHSSXGN-NXEZZACHSA-N |
| XLogP | 2.84 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|