C11H9ClF4O2 — CID 102548175
2-[[1-(3-chloro-4-fluorophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane (PubChem CID 102548175) has the molecular formula C11H9ClF4O2 and a molecular weight of 284.64 g/mol. Its IUPAC name is 2-[[1-(3-chloro-4-fluorophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane.
| Compound Name | 2-[[1-(3-chloro-4-fluorophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane |
|---|---|
| PubChem CID | 102548175 |
| Molecular Formula | C11H9ClF4O2 |
| Molecular Weight | 284.64 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 2-[[1-(3-chloro-4-fluorophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane |
| SMILES | Fc1ccc(C(OCC2CO2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H9ClF4O2/c12-8-3-6(1-2-9(8)13)10(11(14,15)16)18-5-7-4-17-7/h1-3,7,10H,4-5H2 |
| InChIKey | TZCGHUKIKZDTBZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|