C14H19BrO2 — CID 58572474
2-[[(1R)-1-(2-bromo-3-methylphenyl)butoxy]methyl]oxirane (PubChem CID 58572474) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is 2-[[(1R)-1-(2-bromo-3-methylphenyl)butoxy]methyl]oxirane.
| Compound Name | 2-[[(1R)-1-(2-bromo-3-methylphenyl)butoxy]methyl]oxirane |
|---|---|
| PubChem CID | 58572474 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-[[(1R)-1-(2-bromo-3-methylphenyl)butoxy]methyl]oxirane |
| SMILES | CCC[C@@H](OCC1CO1)c1cccc(C)c1Br |
| InChI | InChI=1S/C14H19BrO2/c1-3-5-13(17-9-11-8-16-11)12-7-4-6-10(2)14(12)15/h4,6-7,11,13H,3,5,8-9H2,1-2H3/t11?,13-/m1/s1 |
| InChIKey | UDHDFEASTPAYJD-GLGOKHISSA-N |
| XLogP | 4.01 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|