C14H19BrO3 — CID 58572465
2-[[(1R)-1-(2-bromo-3-methoxyphenyl)butoxy]methyl]oxirane (PubChem CID 58572465) has the molecular formula C14H19BrO3 and a molecular weight of 315.21 g/mol. Its IUPAC name is 2-[[(1R)-1-(2-bromo-3-methoxyphenyl)butoxy]methyl]oxirane.
| Compound Name | 2-[[(1R)-1-(2-bromo-3-methoxyphenyl)butoxy]methyl]oxirane |
|---|---|
| PubChem CID | 58572465 |
| Molecular Formula | C14H19BrO3 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-[[(1R)-1-(2-bromo-3-methoxyphenyl)butoxy]methyl]oxirane |
| SMILES | CCC[C@@H](OCC1CO1)c1cccc(OC)c1Br |
| InChI | InChI=1S/C14H19BrO3/c1-3-5-12(18-9-10-8-17-10)11-6-4-7-13(16-2)14(11)15/h4,6-7,10,12H,3,5,8-9H2,1-2H3/t10?,12-/m1/s1 |
| InChIKey | BSLWUGUQDHWRRR-TVKKRMFBSA-N |
| XLogP | 3.71 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|