About 2-bromo-1,3-dimethoxybenzene;butane;morpholine
2-bromo-1,3-dimethoxybenzene;butane;morpholine (PubChem CID 170603112) has the molecular formula C16H28BrNO3
and a molecular weight of 362.31 g/mol. Its IUPAC name is 2-bromo-1,3-dimethoxybenzene;butane;morpholine.
Molecular Properties
| Compound Name | 2-bromo-1,3-dimethoxybenzene;butane;morpholine |
| PubChem CID | 170603112 |
| Molecular Formula | C16H28BrNO3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-bromo-1,3-dimethoxybenzene;butane;morpholine |
| SMILES | C1COCCN1.CCCC.COc1cccc(OC)c1Br |
| InChI | InChI=1S/C8H9BrO2.C4H9NO.C4H10/c1-10-6-4-3-5-7(11-2)8(6)9;1-3-6-4-2-5-1;1-3-4-2/h3-5H,1-2H3;5H,1-4H2;3-4H2,1-2H3 |
| InChIKey | REASMINKFMIMBY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bromo-1,3-dimethoxybenzene;butane;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,3-dimethoxybenzene;butane;morpholine?
The IUPAC name of 2-bromo-1,3-dimethoxybenzene;butane;morpholine (CID 170603112) is 2-bromo-1,3-dimethoxybenzene;butane;morpholine.
What is the SMILES notation for 2-bromo-1,3-dimethoxybenzene;butane;morpholine?
The canonical SMILES for 2-bromo-1,3-dimethoxybenzene;butane;morpholine is C1COCCN1.CCCC.COc1cccc(OC)c1Br.
What is the InChIKey of 2-bromo-1,3-dimethoxybenzene;butane;morpholine?
The InChIKey is REASMINKFMIMBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrO2.C4H9NO.C4H10/c1-10-6-4-3-5-7(11-2)8(6)9;1-3-6-4-2-5-1;1-3-4-2/h3-5H,1-2H3;5H,1-4H2;3-4H2,1-2H3.
What are the key properties of 2-bromo-1,3-dimethoxybenzene;butane;morpholine?
2-bromo-1,3-dimethoxybenzene;butane;morpholine has a molecular weight of 362.31 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,3-dimethoxybenzene;butane;morpholine is sourced from PubChem (CID 170603112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).