C16H28BrNO3 — CID 170603112
2-bromo-1,3-dimethoxybenzene;butane;morpholine (PubChem CID 170603112) has the molecular formula C16H28BrNO3 and a molecular weight of 362.31 g/mol. Its IUPAC name is 2-bromo-1,3-dimethoxybenzene;butane;morpholine.
| Compound Name | 2-bromo-1,3-dimethoxybenzene;butane;morpholine |
|---|---|
| PubChem CID | 170603112 |
| Molecular Formula | C16H28BrNO3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-bromo-1,3-dimethoxybenzene;butane;morpholine |
| SMILES | C1COCCN1.CCCC.COc1cccc(OC)c1Br |
| InChI | InChI=1S/C8H9BrO2.C4H9NO.C4H10/c1-10-6-4-3-5-7(11-2)8(6)9;1-3-6-4-2-5-1;1-3-4-2/h3-5H,1-2H3;5H,1-4H2;3-4H2,1-2H3 |
| InChIKey | REASMINKFMIMBY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |