C12H16BrNO3 — CID 117486500
2-(3-bromo-2,4-dimethoxyphenyl)morpholine (PubChem CID 117486500) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is 2-(3-bromo-2,4-dimethoxyphenyl)morpholine.
| Compound Name | 2-(3-bromo-2,4-dimethoxyphenyl)morpholine |
|---|---|
| PubChem CID | 117486500 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2-(3-bromo-2,4-dimethoxyphenyl)morpholine |
| SMILES | COc1ccc(C2CNCCO2)c(OC)c1Br |
| InChI | InChI=1S/C12H16BrNO3/c1-15-9-4-3-8(12(16-2)11(9)13)10-7-14-5-6-17-10/h3-4,10,14H,5-7H2,1-2H3 |
| InChIKey | UWPKJZSLKPDSRR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |