C12H16FNO3 — CID 117354893
2-(5-fluoro-2,3-dimethoxyphenyl)morpholine (PubChem CID 117354893) has the molecular formula C12H16FNO3 and a molecular weight of 241.26 g/mol. Its IUPAC name is 2-(5-fluoro-2,3-dimethoxyphenyl)morpholine.
| Compound Name | 2-(5-fluoro-2,3-dimethoxyphenyl)morpholine |
|---|---|
| PubChem CID | 117354893 |
| Molecular Formula | C12H16FNO3 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-(5-fluoro-2,3-dimethoxyphenyl)morpholine |
| SMILES | COc1cc(F)cc(C2CNCCO2)c1OC |
| InChI | InChI=1S/C12H16FNO3/c1-15-10-6-8(13)5-9(12(10)16-2)11-7-14-3-4-17-11/h5-6,11,14H,3-4,7H2,1-2H3 |
| InChIKey | PGCZREVXWGVPCN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |