C12H16ClNO3 — CID 117397861
2-(2-chloro-4,5-dimethoxyphenyl)morpholine (PubChem CID 117397861) has the molecular formula C12H16ClNO3 and a molecular weight of 257.72 g/mol. Its IUPAC name is 2-(2-chloro-4,5-dimethoxyphenyl)morpholine.
| Compound Name | 2-(2-chloro-4,5-dimethoxyphenyl)morpholine |
|---|---|
| PubChem CID | 117397861 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-(2-chloro-4,5-dimethoxyphenyl)morpholine |
| SMILES | COc1cc(Cl)c(C2CNCCO2)cc1OC |
| InChI | InChI=1S/C12H16ClNO3/c1-15-10-5-8(9(13)6-11(10)16-2)12-7-14-3-4-17-12/h5-6,12,14H,3-4,7H2,1-2H3 |
| InChIKey | DSLHDRRFGSSWFA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |