C10H11Cl2NO2 — CID 82480089
5-(2,5-dichloro-4-methoxyphenyl)-1,3-oxazolidine (PubChem CID 82480089) has the molecular formula C10H11Cl2NO2 and a molecular weight of 248.11 g/mol. Its IUPAC name is 5-(2,5-dichloro-4-methoxyphenyl)-1,3-oxazolidine.
| Compound Name | 5-(2,5-dichloro-4-methoxyphenyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 82480089 |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 5-(2,5-dichloro-4-methoxyphenyl)-1,3-oxazolidine |
| SMILES | COc1cc(Cl)c(C2CNCO2)cc1Cl |
| InChI | InChI=1S/C10H11Cl2NO2/c1-14-9-3-7(11)6(2-8(9)12)10-4-13-5-15-10/h2-3,10,13H,4-5H2,1H3 |
| InChIKey | CBTHXHSSESELNO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |