C13H18ClNO4 — CID 117464374
2-(6-chloro-2,3,4-trimethoxyphenyl)morpholine (PubChem CID 117464374) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is 2-(6-chloro-2,3,4-trimethoxyphenyl)morpholine.
| Compound Name | 2-(6-chloro-2,3,4-trimethoxyphenyl)morpholine |
|---|---|
| PubChem CID | 117464374 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-(6-chloro-2,3,4-trimethoxyphenyl)morpholine |
| SMILES | COc1cc(Cl)c(C2CNCCO2)c(OC)c1OC |
| InChI | InChI=1S/C13H18ClNO4/c1-16-9-6-8(14)11(10-7-15-4-5-19-10)13(18-3)12(9)17-2/h6,10,15H,4-5,7H2,1-3H3 |
| InChIKey | KSKZWUMMZNDCGR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |