C13H17Cl2NO2 — CID 151576016
5-[5-chloro-3-(1-chloroethyl)-2-methoxy-6-methylphenyl]-1,3-oxazolidine (PubChem CID 151576016) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 5-[5-chloro-3-(1-chloroethyl)-2-methoxy-6-methylphenyl]-1,3-oxazolidine.
| Compound Name | 5-[5-chloro-3-(1-chloroethyl)-2-methoxy-6-methylphenyl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 151576016 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 5-[5-chloro-3-(1-chloroethyl)-2-methoxy-6-methylphenyl]-1,3-oxazolidine |
| SMILES | COc1c(C(C)Cl)cc(Cl)c(C)c1C1CNCO1 |
| InChI | InChI=1S/C13H17Cl2NO2/c1-7-10(15)4-9(8(2)14)13(17-3)12(7)11-5-16-6-18-11/h4,8,11,16H,5-6H2,1-3H3 |
| InChIKey | QFLSBSZMWGRDSS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|