C9H9Cl2NO — CID 142653590
5-(2,4-dichlorophenyl)-1,3-oxazolidine (PubChem CID 142653590) has the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-1,3-oxazolidine.
| Compound Name | 5-(2,4-dichlorophenyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 142653590 |
| Molecular Formula | C9H9Cl2NO |
| Molecular Weight | 218.08 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-1,3-oxazolidine |
| SMILES | Clc1ccc(C2CNCO2)c(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2NO/c10-6-1-2-7(8(11)3-6)9-4-12-5-13-9/h1-3,9,12H,4-5H2 |
| InChIKey | IYNOMDWELKUHNT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.08 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |