C11H12ClNO3 — CID 174949495
5-chloro-2-morpholin-2-ylbenzoic acid (PubChem CID 174949495) has the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. Its IUPAC name is 5-chloro-2-morpholin-2-ylbenzoic acid.
| Compound Name | 5-chloro-2-morpholin-2-ylbenzoic acid |
|---|---|
| PubChem CID | 174949495 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 5-chloro-2-morpholin-2-ylbenzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1C1CNCCO1 |
| InChI | InChI=1S/C11H12ClNO3/c12-7-1-2-8(9(5-7)11(14)15)10-6-13-3-4-16-10/h1-2,5,10,13H,3-4,6H2,(H,14,15) |
| InChIKey | QEHBVJCPCWOSTR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |