C10H10ClF2NO — CID 117339537
2-(2-chloro-3,6-difluorophenyl)morpholine (PubChem CID 117339537) has the molecular formula C10H10ClF2NO and a molecular weight of 233.64 g/mol. Its IUPAC name is 2-(2-chloro-3,6-difluorophenyl)morpholine.
| Compound Name | 2-(2-chloro-3,6-difluorophenyl)morpholine |
|---|---|
| PubChem CID | 117339537 |
| Molecular Formula | C10H10ClF2NO |
| Molecular Weight | 233.64 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-(2-chloro-3,6-difluorophenyl)morpholine |
| SMILES | Fc1ccc(F)c(C2CNCCO2)c1Cl |
| InChI | InChI=1S/C10H10ClF2NO/c11-10-7(13)2-1-6(12)9(10)8-5-14-3-4-15-8/h1-2,8,14H,3-5H2 |
| InChIKey | YNGRKKPPLCYISJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.64 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|