C10H11F2NO2 — CID 84783760
2,3-difluoro-6-morpholin-2-ylphenol (PubChem CID 84783760) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 2,3-difluoro-6-morpholin-2-ylphenol.
| Compound Name | 2,3-difluoro-6-morpholin-2-ylphenol |
|---|---|
| PubChem CID | 84783760 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2,3-difluoro-6-morpholin-2-ylphenol |
| SMILES | Oc1c(C2CNCCO2)ccc(F)c1F |
| InChI | InChI=1S/C10H11F2NO2/c11-7-2-1-6(10(14)9(7)12)8-5-13-3-4-15-8/h1-2,8,13-14H,3-5H2 |
| InChIKey | RVLDOPBJNCAUDE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |