C12H17NO2 — CID 117296490
2,6-dimethyl-3-morpholin-2-ylphenol (PubChem CID 117296490) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2,6-dimethyl-3-morpholin-2-ylphenol.
| Compound Name | 2,6-dimethyl-3-morpholin-2-ylphenol |
|---|---|
| PubChem CID | 117296490 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2,6-dimethyl-3-morpholin-2-ylphenol |
| SMILES | Cc1ccc(C2CNCCO2)c(C)c1O |
| InChI | InChI=1S/C12H17NO2/c1-8-3-4-10(9(2)12(8)14)11-7-13-5-6-15-11/h3-4,11,13-14H,5-7H2,1-2H3 |
| InChIKey | SLOKYZOWJOUZRA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |