C18H17ClFNO2 — CID 58315805
1-(4-chloro-2-fluorophenyl)-2-(4-morpholin-2-ylphenyl)ethanone (PubChem CID 58315805) has the molecular formula C18H17ClFNO2 and a molecular weight of 333.79 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-2-(4-morpholin-2-ylphenyl)ethanone.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-2-(4-morpholin-2-ylphenyl)ethanone |
|---|---|
| PubChem CID | 58315805 |
| Molecular Formula | C18H17ClFNO2 |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-2-(4-morpholin-2-ylphenyl)ethanone |
| SMILES | O=C(Cc1ccc(C2CNCCO2)cc1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C18H17ClFNO2/c19-14-5-6-15(16(20)10-14)17(22)9-12-1-3-13(4-2-12)18-11-21-7-8-23-18/h1-6,10,18,21H,7-9,11H2 |
| InChIKey | BUUONVXTFOARON-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |