C11H11F2NO3 — CID 117359158
2,6-difluoro-4-morpholin-2-ylbenzoic acid (PubChem CID 117359158) has the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. Its IUPAC name is 2,6-difluoro-4-morpholin-2-ylbenzoic acid.
| Compound Name | 2,6-difluoro-4-morpholin-2-ylbenzoic acid |
|---|---|
| PubChem CID | 117359158 |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2,6-difluoro-4-morpholin-2-ylbenzoic acid |
| SMILES | O=C(O)c1c(F)cc(C2CNCCO2)cc1F |
| InChI | InChI=1S/C11H11F2NO3/c12-7-3-6(9-5-14-1-2-17-9)4-8(13)10(7)11(15)16/h3-4,9,14H,1-2,5H2,(H,15,16) |
| InChIKey | CCEGWXKUPJMGJS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |